C18H22O — CID 98162500
(1S,10R)-3,6-dimethyl-16-oxatetracyclo[8.4.3.01,10.02,7]heptadeca-2,4,6,12-tetraene (PubChem CID 98162500) has the molecular formula C18H22O and a molecular weight of 254.37 g/mol. Its IUPAC name is (1S,10R)-3,6-dimethyl-16-oxatetracyclo[8.4.3.01,10.02,7]heptadeca-2,4,6,12-tetraene.
| Compound Name | (1S,10R)-3,6-dimethyl-16-oxatetracyclo[8.4.3.01,10.02,7]heptadeca-2,4,6,12-tetraene |
|---|---|
| PubChem CID | 98162500 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | (1S,10R)-3,6-dimethyl-16-oxatetracyclo[8.4.3.01,10.02,7]heptadeca-2,4,6,12-tetraene |
| SMILES | Cc1ccc(C)c2c1CC[C@@]13CC=CC[C@]21COC3 |
| InChI | InChI=1S/C18H22O/c1-13-5-6-14(2)16-15(13)7-10-17-8-3-4-9-18(16,17)12-19-11-17/h3-6H,7-12H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | JKFOXPBVTPANDP-MSOLQXFVSA-N |
| XLogP | 3.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|