C9H10N2O3 — CID 91180713
4H-1,3-benzodioxin-6-ylurea (PubChem CID 91180713) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 4H-1,3-benzodioxin-6-ylurea.
| Compound Name | 4H-1,3-benzodioxin-6-ylurea |
|---|---|
| PubChem CID | 91180713 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 4H-1,3-benzodioxin-6-ylurea |
| SMILES | NC(=O)Nc1ccc2c(c1)COCO2 |
| InChI | InChI=1S/C9H10N2O3/c10-9(12)11-7-1-2-8-6(3-7)4-13-5-14-8/h1-3H,4-5H2,(H3,10,11,12) |
| InChIKey | CHUBVIWPSXNPOE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |