C18H12Cl2O2S — CID 91187611
2-(2-benzothiophen-1-yl)-4-(2,4-dichlorophenyl)but-2-enoic acid (PubChem CID 91187611) has the molecular formula C18H12Cl2O2S and a molecular weight of 363.27 g/mol. Its IUPAC name is 2-(2-benzothiophen-1-yl)-4-(2,4-dichlorophenyl)but-2-enoic acid.
| Compound Name | 2-(2-benzothiophen-1-yl)-4-(2,4-dichlorophenyl)but-2-enoic acid |
|---|---|
| PubChem CID | 91187611 |
| Molecular Formula | C18H12Cl2O2S |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 2-(2-benzothiophen-1-yl)-4-(2,4-dichlorophenyl)but-2-enoic acid |
| SMILES | O=C(O)C(=CCc1ccc(Cl)cc1Cl)c1scc2ccccc12 |
| InChI | InChI=1S/C18H12Cl2O2S/c19-13-7-5-11(16(20)9-13)6-8-15(18(21)22)17-14-4-2-1-3-12(14)10-23-17/h1-5,7-10H,6H2,(H,21,22) |
| InChIKey | REBFXRFOTIPNIF-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|