C12H6Cl2N6O2 — CID 91188964
3,5-dichloro-4-[5-(3-nitrophenyl)tetrazol-2-yl]pyridine (PubChem CID 91188964) has the molecular formula C12H6Cl2N6O2 and a molecular weight of 337.13 g/mol. Its IUPAC name is 3,5-dichloro-4-[5-(3-nitrophenyl)tetrazol-2-yl]pyridine.
| Compound Name | 3,5-dichloro-4-[5-(3-nitrophenyl)tetrazol-2-yl]pyridine |
|---|---|
| PubChem CID | 91188964 |
| Molecular Formula | C12H6Cl2N6O2 |
| Molecular Weight | 337.13 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 3,5-dichloro-4-[5-(3-nitrophenyl)tetrazol-2-yl]pyridine |
| SMILES | O=[N+]([O-])c1cccc(-c2nnn(-c3c(Cl)cncc3Cl)n2)c1 |
| InChI | InChI=1S/C12H6Cl2N6O2/c13-9-5-15-6-10(14)11(9)19-17-12(16-18-19)7-2-1-3-8(4-7)20(21)22/h1-6H |
| InChIKey | NHKHYNCPESMQGT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.13 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|