C29H37F6N3O — CID 91189229
3-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]-N-(2,2,2-trifluoroethyl)prop-2-en-1-amine (PubChem CID 91189229) has the molecular formula C29H37F6N3O and a molecular weight of 557.62 g/mol. Its IUPAC name is 3-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]-N-(2,2,2-trifluoroethyl)prop-2-en-1-amine.
| Compound Name | 3-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]-N-(2,2,2-trifluoroethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 91189229 |
| Molecular Formula | C29H37F6N3O |
| Molecular Weight | 557.62 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | 3-[4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]-N-(2,2,2-trifluoroethyl)prop-2-en-1-amine |
| SMILES | C[C@H]1c2c([nH]c3ccc(C(F)(F)F)cc23)C[C@H]2CCN(CCC3(C=CCNCC(F)(F)F)CCOCC3)C[C@@H]21 |
| InChI | InChI=1S/C29H37F6N3O/c1-19-23-17-38(12-7-27(8-13-39-14-9-27)6-2-10-36-18-28(30,31)32)11-5-20(23)15-25-26(19)22-16-21(29(33,34)35)3-4-24(22)37-25/h2-4,6,16,19-20,23,36-37H,5,7-15,17-18H2,1H3/t19-,20-,23-/m1/s1 |
| InChIKey | UQMBSSFGWUFWQT-TXTKFYIRSA-N |
| XLogP | 6.68 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.62 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|