C24H30ClN3O — CID 91194001
1-(8-chloro-2-propan-2-yl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3-methyl-2-pyridin-4-ylbutan-2-ol (PubChem CID 91194001) has the molecular formula C24H30ClN3O and a molecular weight of 411.98 g/mol. Its IUPAC name is 1-(8-chloro-2-propan-2-yl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3-methyl-2-pyridin-4-ylbutan-2-ol.
| Compound Name | 1-(8-chloro-2-propan-2-yl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3-methyl-2-pyridin-4-ylbutan-2-ol |
|---|---|
| PubChem CID | 91194001 |
| Molecular Formula | C24H30ClN3O |
| Molecular Weight | 411.98 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 1-(8-chloro-2-propan-2-yl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3-methyl-2-pyridin-4-ylbutan-2-ol |
| SMILES | CC(C)N1CCc2c(c3cc(Cl)ccc3n2CC(O)(c2ccncc2)C(C)C)C1 |
| InChI | InChI=1S/C24H30ClN3O/c1-16(2)24(29,18-7-10-26-11-8-18)15-28-22-6-5-19(25)13-20(22)21-14-27(17(3)4)12-9-23(21)28/h5-8,10-11,13,16-17,29H,9,12,14-15H2,1-4H3 |
| InChIKey | AGXNHIJCQFOVIT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.98 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|