C8H17NO3 — CID 91197511
(2R,6R)-4-amino-2,4,6-trimethyl-6-tritiooxyoxan-3-ol (PubChem CID 91197511) has the molecular formula C8H17NO3 and a molecular weight of 177.24 g/mol. Its IUPAC name is (2R,6R)-4-amino-2,4,6-trimethyl-6-tritiooxyoxan-3-ol.
| Compound Name | (2R,6R)-4-amino-2,4,6-trimethyl-6-tritiooxyoxan-3-ol |
|---|---|
| PubChem CID | 91197511 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 177.24 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | (2R,6R)-4-amino-2,4,6-trimethyl-6-tritiooxyoxan-3-ol |
| SMILES | [3H]O[C@@]1(C)CC(C)(N)C(O)[C@@H](C)O1 |
| InChI | InChI=1S/C8H17NO3/c1-5-6(10)7(2,9)4-8(3,11)12-5/h5-6,10-11H,4,9H2,1-3H3/t5-,6?,7?,8-/m1/s1/i11T |
| InChIKey | MQRZWIIOYLJLPM-AYIQMIEESA-N |
| XLogP | -0.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.24 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |