About 3-phenoxyazulene-1,7-dione
3-phenoxyazulene-1,7-dione (PubChem CID 91200824) has the molecular formula C16H10O3
and a molecular weight of 250.25 g/mol. Its IUPAC name is 3-phenoxyazulene-1,7-dione.
Molecular Properties
| Compound Name | 3-phenoxyazulene-1,7-dione |
| PubChem CID | 91200824 |
| Molecular Formula | C16H10O3 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 3-phenoxyazulene-1,7-dione |
| SMILES | O=C1C=C(Oc2ccccc2)c2cccc(=O)cc21 |
| InChI | InChI=1S/C16H10O3/c17-11-5-4-8-13-14(9-11)15(18)10-16(13)19-12-6-2-1-3-7-12/h1-10H |
| InChIKey | PWSOAWCIVLGOPS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-phenoxyazulene-1,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenoxyazulene-1,7-dione?
The IUPAC name of 3-phenoxyazulene-1,7-dione (CID 91200824) is 3-phenoxyazulene-1,7-dione.
What is the SMILES notation for 3-phenoxyazulene-1,7-dione?
The canonical SMILES for 3-phenoxyazulene-1,7-dione is O=C1C=C(Oc2ccccc2)c2cccc(=O)cc21.
What is the InChIKey of 3-phenoxyazulene-1,7-dione?
The InChIKey is PWSOAWCIVLGOPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O3/c17-11-5-4-8-13-14(9-11)15(18)10-16(13)19-12-6-2-1-3-7-12/h1-10H.
What are the key properties of 3-phenoxyazulene-1,7-dione?
3-phenoxyazulene-1,7-dione has a molecular weight of 250.25 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenoxyazulene-1,7-dione is sourced from PubChem (CID 91200824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).