C6H10Cl3N — CID 91207779
3,4,4-trichloro-N,N-dimethylbut-3-en-1-amine (PubChem CID 91207779) has the molecular formula C6H10Cl3N and a molecular weight of 202.51 g/mol. Its IUPAC name is 3,4,4-trichloro-N,N-dimethylbut-3-en-1-amine.
| Compound Name | 3,4,4-trichloro-N,N-dimethylbut-3-en-1-amine |
|---|---|
| PubChem CID | 91207779 |
| Molecular Formula | C6H10Cl3N |
| Molecular Weight | 202.51 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 3,4,4-trichloro-N,N-dimethylbut-3-en-1-amine |
| SMILES | CN(C)CCC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C6H10Cl3N/c1-10(2)4-3-5(7)6(8)9/h3-4H2,1-2H3 |
| InChIKey | IEVZYYXDALZCLS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |