C32H38N6O3 — CID 91216825
6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[3-ethyl-4-(pyrazol-1-ylmethyl)phenyl]ethyl]oxane-2,4-dione (PubChem CID 91216825) has the molecular formula C32H38N6O3 and a molecular weight of 554.70 g/mol. Its IUPAC name is 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[3-ethyl-4-(pyrazol-1-ylmethyl)phenyl]ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[3-ethyl-4-(pyrazol-1-ylmethyl)phenyl]ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91216825 |
| Molecular Formula | C32H38N6O3 |
| Molecular Weight | 554.70 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[3-ethyl-4-(pyrazol-1-ylmethyl)phenyl]ethyl]oxane-2,4-dione |
| SMILES | CCc1cc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4nc(C)cc(C)n4n3)C(=O)O2)ccc1Cn1cccn1 |
| InChI | InChI=1S/C32H38N6O3/c1-4-24-17-23(10-11-25(24)20-37-15-7-14-33-37)12-13-32(26-8-5-6-9-26)19-28(39)27(30(40)41-32)18-29-35-31-34-21(2)16-22(3)38(31)36-29/h7,10-11,14-17,26-27H,4-6,8-9,12-13,18-20H2,1-3H3 |
| InChIKey | GMINTTIICPZONH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 104.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|