C20H32ClNO — CID 91219902
9-(1-chloro-6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)nonan-1-amine (PubChem CID 91219902) has the molecular formula C20H32ClNO and a molecular weight of 337.94 g/mol. Its IUPAC name is 9-(1-chloro-6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)nonan-1-amine.
| Compound Name | 9-(1-chloro-6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)nonan-1-amine |
|---|---|
| PubChem CID | 91219902 |
| Molecular Formula | C20H32ClNO |
| Molecular Weight | 337.94 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 9-(1-chloro-6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)nonan-1-amine |
| SMILES | COc1ccc2c(c1)CCC(CCCCCCCCCN)C2Cl |
| InChI | InChI=1S/C20H32ClNO/c1-23-18-12-13-19-17(15-18)11-10-16(20(19)21)9-7-5-3-2-4-6-8-14-22/h12-13,15-16,20H,2-11,14,22H2,1H3 |
| InChIKey | HXMQMZZMLDREIQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.94 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|