C8H16N2 — CID 91223219
2-ethenyl-N,N,N'-trimethylprop-1-ene-1,3-diamine (PubChem CID 91223219) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 2-ethenyl-N,N,N'-trimethylprop-1-ene-1,3-diamine.
| Compound Name | 2-ethenyl-N,N,N'-trimethylprop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 91223219 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 2-ethenyl-N,N,N'-trimethylprop-1-ene-1,3-diamine |
| SMILES | C=CC(=CN(C)C)CNC |
| InChI | InChI=1S/C8H16N2/c1-5-8(6-9-2)7-10(3)4/h5,7,9H,1,6H2,2-4H3 |
| InChIKey | PCZWJFOWFIQPCF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|