About CID 91232918
CID 91232918 (PubChem CID 91232918) has the molecular formula C6H4BN2
and a molecular weight of 114.92 g/mol.
Molecular Properties
| Compound Name | CID 91232918 |
| PubChem CID | 91232918 |
| Molecular Formula | C6H4BN2 |
| Molecular Weight | 114.92 g/mol |
| Exact Mass | 115.05 |
| IUPAC Name | — |
| SMILES | [B]1N=Nc2ccccc21 |
| InChI | InChI=1S/C6H4BN2/c1-2-4-6-5(3-1)7-9-8-6/h1-4H |
| InChIKey | FVVGSOQWADBDHX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.92 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 91232918 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91232918?
The IUPAC name of CID 91232918 (CID 91232918) is not available.
What is the SMILES notation for CID 91232918?
The canonical SMILES for CID 91232918 is [B]1N=Nc2ccccc21.
What is the InChIKey of CID 91232918?
The InChIKey is FVVGSOQWADBDHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BN2/c1-2-4-6-5(3-1)7-9-8-6/h1-4H.
What are the key properties of CID 91232918?
CID 91232918 has a molecular weight of 114.92 g/mol, XLogP of 1.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91232918 is sourced from PubChem (CID 91232918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).