C28H42N2O8 — CID 91250628
dimethyl 2-methyl-3-oxobutanedioate;4,5-dimethyl-1-(2,3,4,5,6-pentamethylphenyl)pyrazolidin-3-one;methyl 2-methylprop-2-enoate (PubChem CID 91250628) has the molecular formula C28H42N2O8 and a molecular weight of 534.65 g/mol. Its IUPAC name is dimethyl 2-methyl-3-oxobutanedioate;4,5-dimethyl-1-(2,3,4,5,6-pentamethylphenyl)pyrazolidin-3-one;methyl 2-methylprop-2-enoate.
| Compound Name | dimethyl 2-methyl-3-oxobutanedioate;4,5-dimethyl-1-(2,3,4,5,6-pentamethylphenyl)pyrazolidin-3-one;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91250628 |
| Molecular Formula | C28H42N2O8 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | dimethyl 2-methyl-3-oxobutanedioate;4,5-dimethyl-1-(2,3,4,5,6-pentamethylphenyl)pyrazolidin-3-one;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.COC(=O)C(=O)C(C)C(=O)OC.Cc1c(C)c(C)c(N2NC(=O)C(C)C2C)c(C)c1C |
| InChI | InChI=1S/C16H24N2O.C7H10O5.C5H8O2/c1-8-9(2)11(4)15(12(5)10(8)3)18-14(7)13(6)16(19)17-18;1-4(6(9)11-2)5(8)7(10)12-3;1-4(2)5(6)7-3/h13-14H,1-7H3,(H,17,19);4H,1-3H3;1H2,2-3H3 |
| InChIKey | ZQKKFZSREMFNDN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|