C10H7NO5 — CID 91256491
2-(trioxolan-4-yl)isoindole-1,3-dione (PubChem CID 91256491) has the molecular formula C10H7NO5 and a molecular weight of 221.17 g/mol. Its IUPAC name is 2-(trioxolan-4-yl)isoindole-1,3-dione.
| Compound Name | 2-(trioxolan-4-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 91256491 |
| Molecular Formula | C10H7NO5 |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 2-(trioxolan-4-yl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C1COOO1 |
| InChI | InChI=1S/C10H7NO5/c12-9-6-3-1-2-4-7(6)10(13)11(9)8-5-14-16-15-8/h1-4,8H,5H2 |
| InChIKey | HBUITHZRKKSMHN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|