C10H17N3O3S2 — CID 91261502
1-propyl-3,5-bis(2-sulfanylethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 91261502) has the molecular formula C10H17N3O3S2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 1-propyl-3,5-bis(2-sulfanylethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-propyl-3,5-bis(2-sulfanylethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 91261502 |
| Molecular Formula | C10H17N3O3S2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 1-propyl-3,5-bis(2-sulfanylethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCn1c(=O)n(CCS)c(=O)n(CCS)c1=O |
| InChI | InChI=1S/C10H17N3O3S2/c1-2-3-11-8(14)12(4-6-17)10(16)13(5-7-18)9(11)15/h17-18H,2-7H2,1H3 |
| InChIKey | WNGYSQXEHVIZTO-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|