C8H13- — CID 91261810
1,2-dimethyl-3-prop-1-en-2-ylcyclopropane (PubChem CID 91261810) has the molecular formula C8H13- and a molecular weight of 109.19 g/mol. Its IUPAC name is 1,2-dimethyl-3-prop-1-en-2-ylcyclopropane.
| Compound Name | 1,2-dimethyl-3-prop-1-en-2-ylcyclopropane |
|---|---|
| PubChem CID | 91261810 |
| Molecular Formula | C8H13- |
| Molecular Weight | 109.19 g/mol |
| Exact Mass | 109.10 |
| IUPAC Name | 1,2-dimethyl-3-prop-1-en-2-ylcyclopropane |
| SMILES | C=C([CH2-])C1C(C)C1C |
| InChI | InChI=1S/C8H13/c1-5(2)8-6(3)7(8)4/h6-8H,1-2H2,3-4H3/q-1 |
| InChIKey | JMSPVDCOTCYCQH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|