C21H32O3 — CID 91292087
2-[(2R,11S,12S,15R,16R)-16-methyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadec-1(18)-en-15-yl]ethoxymethanol (PubChem CID 91292087) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is 2-[(2R,11S,12S,15R,16R)-16-methyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadec-1(18)-en-15-yl]ethoxymethanol.
| Compound Name | 2-[(2R,11S,12S,15R,16R)-16-methyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadec-1(18)-en-15-yl]ethoxymethanol |
|---|---|
| PubChem CID | 91292087 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 2-[(2R,11S,12S,15R,16R)-16-methyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadec-1(18)-en-15-yl]ethoxymethanol |
| SMILES | C[C@]12CC=C3[C@@H](CCC4CC5OC5C[C@@H]34)[C@@H]1CC[C@@H]2CCOCO |
| InChI | InChI=1S/C21H32O3/c1-21-8-6-15-16(18(21)5-3-14(21)7-9-23-12-22)4-2-13-10-19-20(24-19)11-17(13)15/h6,13-14,16-20,22H,2-5,7-12H2,1H3/t13?,14-,16-,17-,18+,19?,20?,21-/m1/s1 |
| InChIKey | FCUYICRTKFKOPL-KPLOVNDESA-N |
| XLogP | 3.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|