C10H14F2N2 — CID 91293090
1-(3,5-difluorocyclohexa-1,3-dien-1-yl)piperazine (PubChem CID 91293090) has the molecular formula C10H14F2N2 and a molecular weight of 200.23 g/mol. Its IUPAC name is 1-(3,5-difluorocyclohexa-1,3-dien-1-yl)piperazine.
| Compound Name | 1-(3,5-difluorocyclohexa-1,3-dien-1-yl)piperazine |
|---|---|
| PubChem CID | 91293090 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 1-(3,5-difluorocyclohexa-1,3-dien-1-yl)piperazine |
| SMILES | FC1=CC(F)CC(N2CCNCC2)=C1 |
| InChI | InChI=1S/C10H14F2N2/c11-8-5-9(12)7-10(6-8)14-3-1-13-2-4-14/h5-6,9,13H,1-4,7H2 |
| InChIKey | PXAZWZLWUCGRIX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |