C26H20F3N3O4 — CID 91294687
4-[[3-[3-[4-(3-hydroxyprop-1-ynyl)-3-(trifluoromethyl)anilino]-3-oxoprop-1-enyl]phenoxy]methyl]pyridine-2-carboxamide (PubChem CID 91294687) has the molecular formula C26H20F3N3O4 and a molecular weight of 495.46 g/mol. Its IUPAC name is 4-[[3-[3-[4-(3-hydroxyprop-1-ynyl)-3-(trifluoromethyl)anilino]-3-oxoprop-1-enyl]phenoxy]methyl]pyridine-2-carboxamide.
| Compound Name | 4-[[3-[3-[4-(3-hydroxyprop-1-ynyl)-3-(trifluoromethyl)anilino]-3-oxoprop-1-enyl]phenoxy]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 91294687 |
| Molecular Formula | C26H20F3N3O4 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 4-[[3-[3-[4-(3-hydroxyprop-1-ynyl)-3-(trifluoromethyl)anilino]-3-oxoprop-1-enyl]phenoxy]methyl]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(COc2cccc(C=CC(=O)Nc3ccc(C#CCO)c(C(F)(F)F)c3)c2)ccn1 |
| InChI | InChI=1S/C26H20F3N3O4/c27-26(28,29)22-15-20(8-7-19(22)4-2-12-33)32-24(34)9-6-17-3-1-5-21(13-17)36-16-18-10-11-31-23(14-18)25(30)35/h1,3,5-11,13-15,33H,12,16H2,(H2,30,35)(H,32,34) |
| InChIKey | MTYKGGSFDBVRFI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|