C12H25N — CID 91300842
N-(4,6-dimethylheptan-3-yl)propan-1-imine (PubChem CID 91300842) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is N-(4,6-dimethylheptan-3-yl)propan-1-imine.
| Compound Name | N-(4,6-dimethylheptan-3-yl)propan-1-imine |
|---|---|
| PubChem CID | 91300842 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | N-(4,6-dimethylheptan-3-yl)propan-1-imine |
| SMILES | CC/C=N/C(CC)C(C)CC(C)C |
| InChI | InChI=1S/C12H25N/c1-6-8-13-12(7-2)11(5)9-10(3)4/h8,10-12H,6-7,9H2,1-5H3/b13-8+ |
| InChIKey | XRTSTUPJKLBLEU-MDWZMJQESA-N |
| XLogP | 3.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|