C12H19N2+ — CID 91302856
cyclopropyl-[1-(3-methyl-1,2-dihydropyridin-6-yl)ethyl]-methylideneazanium (PubChem CID 91302856) has the molecular formula C12H19N2+ and a molecular weight of 191.30 g/mol. Its IUPAC name is cyclopropyl-[1-(3-methyl-1,2-dihydropyridin-6-yl)ethyl]-methylideneazanium.
| Compound Name | cyclopropyl-[1-(3-methyl-1,2-dihydropyridin-6-yl)ethyl]-methylideneazanium |
|---|---|
| PubChem CID | 91302856 |
| Molecular Formula | C12H19N2+ |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | cyclopropyl-[1-(3-methyl-1,2-dihydropyridin-6-yl)ethyl]-methylideneazanium |
| SMILES | C=[N+](C1CC1)C(C)C1=CC=C(C)CN1 |
| InChI | InChI=1S/C12H19N2/c1-9-4-7-12(13-8-9)10(2)14(3)11-5-6-11/h4,7,10-11,13H,3,5-6,8H2,1-2H3/q+1 |
| InChIKey | PQGOFSBWLMXLIX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|