About (6-ethyl-2-methyl-1,2-dihydropyridin-4-yl)methanamine
(6-ethyl-2-methyl-1,2-dihydropyridin-4-yl)methanamine (PubChem CID 138702782) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is (6-ethyl-2-methyl-1,2-dihydropyridin-4-yl)methanamine.
Molecular Properties
| Compound Name | (6-ethyl-2-methyl-1,2-dihydropyridin-4-yl)methanamine |
| PubChem CID | 138702782 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (6-ethyl-2-methyl-1,2-dihydropyridin-4-yl)methanamine |
| SMILES | CCC1=CC(CN)=CC(C)N1 |
| InChI | InChI=1S/C9H16N2/c1-3-9-5-8(6-10)4-7(2)11-9/h4-5,7,11H,3,6,10H2,1-2H3 |
| InChIKey | QHXHCILAKBEMBK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-ethyl-2-methyl-1,2-dihydropyridin-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-ethyl-2-methyl-1,2-dihydropyridin-4-yl)methanamine?
The IUPAC name of (6-ethyl-2-methyl-1,2-dihydropyridin-4-yl)methanamine (CID 138702782) is (6-ethyl-2-methyl-1,2-dihydropyridin-4-yl)methanamine.
What is the SMILES notation for (6-ethyl-2-methyl-1,2-dihydropyridin-4-yl)methanamine?
The canonical SMILES for (6-ethyl-2-methyl-1,2-dihydropyridin-4-yl)methanamine is CCC1=CC(CN)=CC(C)N1.
What is the InChIKey of (6-ethyl-2-methyl-1,2-dihydropyridin-4-yl)methanamine?
The InChIKey is QHXHCILAKBEMBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-3-9-5-8(6-10)4-7(2)11-9/h4-5,7,11H,3,6,10H2,1-2H3.
What are the key properties of (6-ethyl-2-methyl-1,2-dihydropyridin-4-yl)methanamine?
(6-ethyl-2-methyl-1,2-dihydropyridin-4-yl)methanamine has a molecular weight of 152.24 g/mol, XLogP of 1.16, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-ethyl-2-methyl-1,2-dihydropyridin-4-yl)methanamine is sourced from PubChem (CID 138702782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).