C12H22N2 — CID 123978975
4-methyl-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine (PubChem CID 123978975) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 4-methyl-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine.
| Compound Name | 4-methyl-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 123978975 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 4-methyl-2-(methylideneamino)-N-pentylpenta-2,4-dien-1-amine |
| SMILES | C=NC(=CC(=C)C)CNCCCCC |
| InChI | InChI=1S/C12H22N2/c1-5-6-7-8-14-10-12(13-4)9-11(2)3/h9,14H,2,4-8,10H2,1,3H3 |
| InChIKey | CTUZBSKCYDPMPD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|