C44H88N2O4 — CID 91304482
(17-amino-6,7,11,14,14,15-hexaethyl-13-formamido-9-hydroxy-3,3,6,7,10,10,11,15,18,18-decamethylnonadecan-5-yl) acetate (PubChem CID 91304482) has the molecular formula C44H88N2O4 and a molecular weight of 709.20 g/mol. Its IUPAC name is (17-amino-6,7,11,14,14,15-hexaethyl-13-formamido-9-hydroxy-3,3,6,7,10,10,11,15,18,18-decamethylnonadecan-5-yl) acetate.
| Compound Name | (17-amino-6,7,11,14,14,15-hexaethyl-13-formamido-9-hydroxy-3,3,6,7,10,10,11,15,18,18-decamethylnonadecan-5-yl) acetate |
|---|---|
| PubChem CID | 91304482 |
| Molecular Formula | C44H88N2O4 |
| Molecular Weight | 709.20 g/mol |
| Exact Mass | 708.67 |
| IUPAC Name | (17-amino-6,7,11,14,14,15-hexaethyl-13-formamido-9-hydroxy-3,3,6,7,10,10,11,15,18,18-decamethylnonadecan-5-yl) acetate |
| SMILES | CCC(C)(C)CC(OC(C)=O)C(C)(CC)C(C)(CC)CC(O)C(C)(C)C(C)(CC)CC(NC=O)C(CC)(CC)C(C)(CC)CC(N)C(C)(C)C |
| InChI | InChI=1S/C44H88N2O4/c1-20-38(12,13)30-36(50-32(8)48)43(19,24-5)41(17,22-3)29-35(49)39(14,15)40(16,21-2)28-34(46-31-47)44(25-6,26-7)42(18,23-4)27-33(45)37(9,10)11/h31,33-36,49H,20-30,45H2,1-19H3,(H,46,47) |
| InChIKey | GYJKWMUQBCWXNQ-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.20 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|