C10H11NO6S — CID 91313337
[(5S)-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]hept-2-en-3-yl] 5-oxopentanoate (PubChem CID 91313337) has the molecular formula C10H11NO6S and a molecular weight of 273.27 g/mol. Its IUPAC name is [(5S)-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]hept-2-en-3-yl] 5-oxopentanoate.
| Compound Name | [(5S)-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]hept-2-en-3-yl] 5-oxopentanoate |
|---|---|
| PubChem CID | 91313337 |
| Molecular Formula | C10H11NO6S |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | [(5S)-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]hept-2-en-3-yl] 5-oxopentanoate |
| SMILES | O=CCCCC(=O)OC1=CN2C(=O)C[C@@H]2S1(=O)=O |
| InChI | InChI=1S/C10H11NO6S/c12-4-2-1-3-9(14)17-10-6-11-7(13)5-8(11)18(10,15)16/h4,6,8H,1-3,5H2/t8-/m0/s1 |
| InChIKey | FCSLWCFJRAZNOP-QMMMGPOBSA-N |
| XLogP | -0.32 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|