C14H12 — CID 91326261
1-penta-2,4-dienylideneindene (PubChem CID 91326261) has the molecular formula C14H12 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-penta-2,4-dienylideneindene.
| Compound Name | 1-penta-2,4-dienylideneindene |
|---|---|
| PubChem CID | 91326261 |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 1-penta-2,4-dienylideneindene |
| SMILES | C=CC=CC=C1C=Cc2ccccc21 |
| InChI | InChI=1S/C14H12/c1-2-3-4-7-12-10-11-13-8-5-6-9-14(12)13/h2-11H,1H2 |
| InChIKey | SPTXHNLBVUSFJX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|