C14H13N — CID 11008841
(3E)-3-inden-1-ylidene-2,2-dimethylpropanenitrile (PubChem CID 11008841) has the molecular formula C14H13N and a molecular weight of 195.27 g/mol. Its IUPAC name is (3E)-3-inden-1-ylidene-2,2-dimethylpropanenitrile.
| Compound Name | (3E)-3-inden-1-ylidene-2,2-dimethylpropanenitrile |
|---|---|
| PubChem CID | 11008841 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | (3E)-3-inden-1-ylidene-2,2-dimethylpropanenitrile |
| SMILES | CC(C)(C#N)/C=C1\C=Cc2ccccc21 |
| InChI | InChI=1S/C14H13N/c1-14(2,10-15)9-12-8-7-11-5-3-4-6-13(11)12/h3-9H,1-2H3/b12-9+ |
| InChIKey | OLVMODRNBXGWNL-FMIVXFBMSA-N |
| XLogP | 3.65 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |