C58H44 — CID 142369783
(9E)-6-[3,5-bis(3,5-diphenylphenyl)phenyl]-9-[(2Z)-penta-2,4-dienylidene]-7,8-dihydrobenzo[7]annulene (PubChem CID 142369783) has the molecular formula C58H44 and a molecular weight of 740.99 g/mol. Its IUPAC name is (9E)-6-[3,5-bis(3,5-diphenylphenyl)phenyl]-9-[(2Z)-penta-2,4-dienylidene]-7,8-dihydrobenzo[7]annulene.
| Compound Name | (9E)-6-[3,5-bis(3,5-diphenylphenyl)phenyl]-9-[(2Z)-penta-2,4-dienylidene]-7,8-dihydrobenzo[7]annulene |
|---|---|
| PubChem CID | 142369783 |
| Molecular Formula | C58H44 |
| Molecular Weight | 740.99 g/mol |
| Exact Mass | 740.34 |
| IUPAC Name | (9E)-6-[3,5-bis(3,5-diphenylphenyl)phenyl]-9-[(2Z)-penta-2,4-dienylidene]-7,8-dihydrobenzo[7]annulene |
| SMILES | C=C/C=C\C=C1/CCC(c2cc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)cc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c2)=Cc2ccccc21 |
| InChI | InChI=1S/C58H44/c1-2-3-8-27-46-30-31-47(32-48-28-17-18-29-58(46)48)53-39-56(54-35-49(42-19-9-4-10-20-42)33-50(36-54)43-21-11-5-12-22-43)41-57(40-53)55-37-51(44-23-13-6-14-24-44)34-52(38-55)45-25-15-7-16-26-45/h2-29,32-41H,1,30-31H2/b8-3-,46-27+ |
| InChIKey | WQYTUGVPKTZXRP-UNBWJTMWSA-N |
| XLogP | 16.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.99 |
| LogP ≤ 5 | 16.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|