C14H27NO — CID 91349138
5-ethyl-2,2,8,8-tetramethyl-10-oxa-5-azabicyclo[7.1.0]decane (PubChem CID 91349138) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 5-ethyl-2,2,8,8-tetramethyl-10-oxa-5-azabicyclo[7.1.0]decane.
| Compound Name | 5-ethyl-2,2,8,8-tetramethyl-10-oxa-5-azabicyclo[7.1.0]decane |
|---|---|
| PubChem CID | 91349138 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 5-ethyl-2,2,8,8-tetramethyl-10-oxa-5-azabicyclo[7.1.0]decane |
| SMILES | CCN1CCC(C)(C)C2OC2C(C)(C)CC1 |
| InChI | InChI=1S/C14H27NO/c1-6-15-9-7-13(2,3)11-12(16-11)14(4,5)8-10-15/h11-12H,6-10H2,1-5H3 |
| InChIKey | LGDKCKURYSOZGT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|