C22H25N5O — CID 91351465
12-[(4-benzylpiperazin-1-yl)methyl]-3,10,11-triazatricyclo[6.4.1.04,13]trideca-1(12),4,6,8(13)-tetraen-9-one (PubChem CID 91351465) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is 12-[(4-benzylpiperazin-1-yl)methyl]-3,10,11-triazatricyclo[6.4.1.04,13]trideca-1(12),4,6,8(13)-tetraen-9-one.
| Compound Name | 12-[(4-benzylpiperazin-1-yl)methyl]-3,10,11-triazatricyclo[6.4.1.04,13]trideca-1(12),4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 91351465 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 12-[(4-benzylpiperazin-1-yl)methyl]-3,10,11-triazatricyclo[6.4.1.04,13]trideca-1(12),4,6,8(13)-tetraen-9-one |
| SMILES | O=C1NNC(CN2CCN(Cc3ccccc3)CC2)=C2CNc3cccc1c32 |
| InChI | InChI=1S/C22H25N5O/c28-22-17-7-4-8-19-21(17)18(13-23-19)20(24-25-22)15-27-11-9-26(10-12-27)14-16-5-2-1-3-6-16/h1-8,23-24H,9-15H2,(H,25,28) |
| InChIKey | KCQHZQBTDFCVLC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |