C34H28N6O4 — CID 91352264
N-[5-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)furan-2-yl]methanimine oxide;2-[(E)-2-phenylethenyl]-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 91352264) has the molecular formula C34H28N6O4 and a molecular weight of 584.64 g/mol. Its IUPAC name is N-[5-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)furan-2-yl]methanimine oxide;2-[(E)-2-phenylethenyl]-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | N-[5-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)furan-2-yl]methanimine oxide;2-[(E)-2-phenylethenyl]-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 91352264 |
| Molecular Formula | C34H28N6O4 |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | N-[5-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)furan-2-yl]methanimine oxide;2-[(E)-2-phenylethenyl]-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | C=[N+]([O-])c1ccc(-c2nc3cccc4c3n2CCNC4=O)o1.O=C1CCCn2c(/C=C/c3ccccc3)nc3cccc1c32 |
| InChI | InChI=1S/C19H16N2O.C15H12N4O3/c22-17-10-5-13-21-18(12-11-14-6-2-1-3-7-14)20-16-9-4-8-15(17)19(16)21;1-18(21)12-6-5-11(22-12)14-17-10-4-2-3-9-13(10)19(14)8-7-16-15(9)20/h1-4,6-9,11-12H,5,10,13H2;2-6H,1,7-8H2,(H,16,20)/b12-11+; |
| InChIKey | TWIHASBUWGXBJC-CALJPSDSSA-N |
| XLogP | 6.07 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|