C18H10F12O2Si — CID 91360614
[1,2-difluoro-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-diethoxy-(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 91360614) has the molecular formula C18H10F12O2Si and a molecular weight of 514.34 g/mol. Its IUPAC name is [1,2-difluoro-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-diethoxy-(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | [1,2-difluoro-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-diethoxy-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 91360614 |
| Molecular Formula | C18H10F12O2Si |
| Molecular Weight | 514.34 g/mol |
| Exact Mass | 514.03 |
| IUPAC Name | [1,2-difluoro-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-diethoxy-(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | CCO[Si](OCC)(C(F)=C(F)c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H10F12O2Si/c1-3-31-33(32-4-2,17-15(28)13(26)12(25)14(27)16(17)29)18(30)8(21)5-6(19)9(22)11(24)10(23)7(5)20/h3-4H2,1-2H3 |
| InChIKey | YOYUQCQPEOAFFR-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.34 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|