C29H35N2O7S2+ — CID 91361183
ethyl 2-acetamido-3-[2-acetamido-3-[2-[3-[(2E,3Z)-2-ethylidenehexa-3,5-dienoyl]phenyl]propanoylsulfanyl]propanoyl]sulfanylpropanoate (PubChem CID 91361183) has the molecular formula C29H35N2O7S2+ and a molecular weight of 587.74 g/mol. Its IUPAC name is ethyl 2-acetamido-3-[2-acetamido-3-[2-[3-[(2E,3Z)-2-ethylidenehexa-3,5-dienoyl]phenyl]propanoylsulfanyl]propanoyl]sulfanylpropanoate.
| Compound Name | ethyl 2-acetamido-3-[2-acetamido-3-[2-[3-[(2E,3Z)-2-ethylidenehexa-3,5-dienoyl]phenyl]propanoylsulfanyl]propanoyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 91361183 |
| Molecular Formula | C29H35N2O7S2+ |
| Molecular Weight | 587.74 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | ethyl 2-acetamido-3-[2-acetamido-3-[2-[3-[(2E,3Z)-2-ethylidenehexa-3,5-dienoyl]phenyl]propanoylsulfanyl]propanoyl]sulfanylpropanoate |
| SMILES | C=[C+]/C=C\C(=C/C)C(=O)c1cccc(C(C)C(=O)SCC(NC(C)=O)C(=O)SCC(NC(C)=O)C(=O)OCC)c1 |
| InChI | InChI=1S/C29H34N2O7S2/c1-7-10-12-21(8-2)26(34)23-14-11-13-22(15-23)18(4)28(36)39-17-25(31-20(6)33)29(37)40-16-24(30-19(5)32)27(35)38-9-3/h8,10-15,18,24-25H,1,9,16-17H2,2-6H3,(H-,30,31,32,33)/p+1/b12-10-,21-8+ |
| InChIKey | RDCVJNJHVGZGGA-ZXKLSGACSA-O |
| XLogP | 3.56 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.74 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|