C10H13O2S- — CID 91365938
2-(3,5-dimethylphenyl)ethanesulfinate (PubChem CID 91365938) has the molecular formula C10H13O2S- and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)ethanesulfinate.
| Compound Name | 2-(3,5-dimethylphenyl)ethanesulfinate |
|---|---|
| PubChem CID | 91365938 |
| Molecular Formula | C10H13O2S- |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2-(3,5-dimethylphenyl)ethanesulfinate |
| SMILES | Cc1cc(C)cc(CCS(=O)[O-])c1 |
| InChI | InChI=1S/C10H14O2S/c1-8-5-9(2)7-10(6-8)3-4-13(11)12/h5-7H,3-4H2,1-2H3,(H,11,12)/p-1 |
| InChIKey | YROKILLGCZPGBU-UHFFFAOYSA-M |
| XLogP | 1.73 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|