C28H32ClN3O5S — CID 91378633
3-(5-amino-1-methylbenzimidazol-2-yl)sulfanyl-6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione (PubChem CID 91378633) has the molecular formula C28H32ClN3O5S and a molecular weight of 558.10 g/mol. Its IUPAC name is 3-(5-amino-1-methylbenzimidazol-2-yl)sulfanyl-6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione.
| Compound Name | 3-(5-amino-1-methylbenzimidazol-2-yl)sulfanyl-6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione |
|---|---|
| PubChem CID | 91378633 |
| Molecular Formula | C28H32ClN3O5S |
| Molecular Weight | 558.10 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | 3-(5-amino-1-methylbenzimidazol-2-yl)sulfanyl-6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyloxane-2,4-dione |
| SMILES | COc1cc(OC)c(CCC2(C3CCCC3)CC(=O)C(Sc3nc4cc(N)ccc4n3C)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C28H32ClN3O5S/c1-32-21-9-8-18(30)13-20(21)31-27(32)38-25-22(33)15-28(37-26(25)34,17-6-4-5-7-17)11-10-16-12-19(29)24(36-3)14-23(16)35-2/h8-9,12-14,17,25H,4-7,10-11,15,30H2,1-3H3 |
| InChIKey | AYJXPBUHVAOWEL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.10 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|