C23H32O6S — CID 91381816
4-[2-[3-hydroxy-2-[4-[3-(methoxymethyl)phenyl]-3-oxobutyl]-5-oxocyclopentyl]ethylsulfanyl]butanoic acid (PubChem CID 91381816) has the molecular formula C23H32O6S and a molecular weight of 436.57 g/mol. Its IUPAC name is 4-[2-[3-hydroxy-2-[4-[3-(methoxymethyl)phenyl]-3-oxobutyl]-5-oxocyclopentyl]ethylsulfanyl]butanoic acid.
| Compound Name | 4-[2-[3-hydroxy-2-[4-[3-(methoxymethyl)phenyl]-3-oxobutyl]-5-oxocyclopentyl]ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 91381816 |
| Molecular Formula | C23H32O6S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 4-[2-[3-hydroxy-2-[4-[3-(methoxymethyl)phenyl]-3-oxobutyl]-5-oxocyclopentyl]ethylsulfanyl]butanoic acid |
| SMILES | COCc1cccc(CC(=O)CCC2C(O)CC(=O)C2CCSCCCC(=O)O)c1 |
| InChI | InChI=1S/C23H32O6S/c1-29-15-17-5-2-4-16(12-17)13-18(24)7-8-19-20(22(26)14-21(19)25)9-11-30-10-3-6-23(27)28/h2,4-5,12,19-21,25H,3,6-11,13-15H2,1H3,(H,27,28) |
| InChIKey | NOUYUUZVBWZGOP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|