About 3-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.1]octane
3-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.1]octane (PubChem CID 91385368) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.1]octane.
Analyze 3-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.1]octane?
The IUPAC name of 3-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.1]octane (CID 91385368) is 3-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.1]octane.
What is the SMILES notation for 3-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.1]octane?
The canonical SMILES for 3-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.1]octane is C1CC1CN1CC2CNC(C2)C1.
What is the InChIKey of 3-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.1]octane?
The InChIKey is BHBANKKVOVHQDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-2-8(1)5-12-6-9-3-10(7-12)11-4-9/h8-11H,1-7H2.
What are the key properties of 3-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.1]octane?
3-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.1]octane has a molecular weight of 166.27 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.1]octane is sourced from PubChem (CID 91385368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).