C31H52O17 — CID 91388656
4-[4-(2,2-dimethylbutanoyloxy)butylperoxy]butanoic acid;4-[[3-(2,2-dimethylbutanoyloxy)-2-hydroxypropyl]peroxymethyl]cyclobutane-1,2,3-tricarboxylic acid (PubChem CID 91388656) has the molecular formula C31H52O17 and a molecular weight of 696.74 g/mol. Its IUPAC name is 4-[4-(2,2-dimethylbutanoyloxy)butylperoxy]butanoic acid;4-[[3-(2,2-dimethylbutanoyloxy)-2-hydroxypropyl]peroxymethyl]cyclobutane-1,2,3-tricarboxylic acid.
| Compound Name | 4-[4-(2,2-dimethylbutanoyloxy)butylperoxy]butanoic acid;4-[[3-(2,2-dimethylbutanoyloxy)-2-hydroxypropyl]peroxymethyl]cyclobutane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 91388656 |
| Molecular Formula | C31H52O17 |
| Molecular Weight | 696.74 g/mol |
| Exact Mass | 696.32 |
| IUPAC Name | 4-[4-(2,2-dimethylbutanoyloxy)butylperoxy]butanoic acid;4-[[3-(2,2-dimethylbutanoyloxy)-2-hydroxypropyl]peroxymethyl]cyclobutane-1,2,3-tricarboxylic acid |
| SMILES | CCC(C)(C)C(=O)OCC(O)COOCC1C(C(=O)O)C(C(=O)O)C1C(=O)O.CCC(C)(C)C(=O)OCCCCOOCCCC(=O)O |
| InChI | InChI=1S/C17H26O11.C14H26O6/c1-4-17(2,3)16(25)26-5-8(18)6-27-28-7-9-10(13(19)20)12(15(23)24)11(9)14(21)22;1-4-14(2,3)13(17)18-9-5-6-10-19-20-11-7-8-12(15)16/h8-12,18H,4-7H2,1-3H3,(H,19,20)(H,21,22)(H,23,24);4-11H2,1-3H3,(H,15,16) |
| InChIKey | JJRGNBLRSYNZKL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 258.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.74 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|