C25H36ClNO4S — CID 91391893
3-[1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 91391893) has the molecular formula C25H36ClNO4S and a molecular weight of 482.09 g/mol. Its IUPAC name is 3-[1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 3-[1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 91391893 |
| Molecular Formula | C25H36ClNO4S |
| Molecular Weight | 482.09 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 3-[1-chloro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | Cc1nc(C=C(Cl)C2CC3OC3(C)CCCC(C)CCC(=O)C(C)(C)CCC(=O)O2)cs1 |
| InChI | InChI=1S/C25H36ClNO4S/c1-16-7-6-11-25(5)22(31-25)14-20(19(26)13-18-15-32-17(2)27-18)30-23(29)10-12-24(3,4)21(28)9-8-16/h13,15-16,20,22H,6-12,14H2,1-5H3 |
| InChIKey | PROASOLOHKYADQ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 68.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.09 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|