C25H36FNO4S — CID 143687358
1-[(Z)-1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 143687358) has the molecular formula C25H36FNO4S and a molecular weight of 465.63 g/mol. Its IUPAC name is 1-[(Z)-1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 1-[(Z)-1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 143687358 |
| Molecular Formula | C25H36FNO4S |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 1-[(Z)-1-fluoro-2-(2-methyl-1,3-thiazol-4-yl)ethenyl]-8,8,12,16-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | Cc1nc(/C=C(\F)C23CCOC(=O)CCC(C)(C)C(=O)CCC(C)CCCC2(C)O3)cs1 |
| InChI | InChI=1S/C25H36FNO4S/c1-17-7-6-11-24(5)25(31-24,20(26)15-19-16-32-18(2)27-19)13-14-30-22(29)10-12-23(3,4)21(28)9-8-17/h15-17H,6-14H2,1-5H3/b20-15- |
| InChIKey | RKZBIPOOHQYUBL-HKWRFOASSA-N |
| XLogP | 6.20 |
| TPSA | 68.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|