C29H45NO6S — CID 87381100
1,2-dihydroxy-8,8,12,16-tetramethyl-3-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-10-propyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 87381100) has the molecular formula C29H45NO6S and a molecular weight of 535.75 g/mol. Its IUPAC name is 1,2-dihydroxy-8,8,12,16-tetramethyl-3-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-10-propyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 1,2-dihydroxy-8,8,12,16-tetramethyl-3-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-10-propyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 87381100 |
| Molecular Formula | C29H45NO6S |
| Molecular Weight | 535.75 g/mol |
| Exact Mass | 535.30 |
| IUPAC Name | 1,2-dihydroxy-8,8,12,16-tetramethyl-3-[1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-10-propyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CCCC1CC(C)CCCC2(C)OC2(O)C(O)C(C(C)=Cc2csc(C)n2)OC(=O)CCC(C)(C)C1=O |
| InChI | InChI=1S/C29H45NO6S/c1-8-10-21-15-18(2)11-9-13-28(7)29(34,36-28)26(33)24(19(3)16-22-17-37-20(4)30-22)35-23(31)12-14-27(5,6)25(21)32/h16-18,21,24,26,33-34H,8-15H2,1-7H3 |
| InChIKey | MTRSZGUZRQAFOV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.75 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|