C28H40ClNO6 — CID 142025417
3-[1-chloro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-8,8,12,16-tetramethyl-1-(oxiran-2-ylmethyl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 142025417) has the molecular formula C28H40ClNO6 and a molecular weight of 522.08 g/mol. Its IUPAC name is 3-[1-chloro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-8,8,12,16-tetramethyl-1-(oxiran-2-ylmethyl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 3-[1-chloro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-8,8,12,16-tetramethyl-1-(oxiran-2-ylmethyl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 142025417 |
| Molecular Formula | C28H40ClNO6 |
| Molecular Weight | 522.08 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 3-[1-chloro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-8,8,12,16-tetramethyl-1-(oxiran-2-ylmethyl)-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | Cc1nc(C=C(Cl)C2CC3(CC4CO4)OC3(C)CCCC(C)CCC(=O)C(C)(C)CCC(=O)O2)co1 |
| InChI | InChI=1S/C28H40ClNO6/c1-18-7-6-11-27(5)28(36-27,14-21-17-34-21)15-23(22(29)13-20-16-33-19(2)30-20)35-25(32)10-12-26(3,4)24(31)9-8-18/h13,16,18,21,23H,6-12,14-15,17H2,1-5H3 |
| InChIKey | ZZBGKDJUINFWNI-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 94.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.08 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|