C18H39NO2S — CID 91398606
4-[2,6-dimethylheptan-4-yl(sulfino)amino]-2,6-dimethylheptane (PubChem CID 91398606) has the molecular formula C18H39NO2S and a molecular weight of 333.58 g/mol. Its IUPAC name is 4-[2,6-dimethylheptan-4-yl(sulfino)amino]-2,6-dimethylheptane.
| Compound Name | 4-[2,6-dimethylheptan-4-yl(sulfino)amino]-2,6-dimethylheptane |
|---|---|
| PubChem CID | 91398606 |
| Molecular Formula | C18H39NO2S |
| Molecular Weight | 333.58 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | 4-[2,6-dimethylheptan-4-yl(sulfino)amino]-2,6-dimethylheptane |
| SMILES | CC(C)CC(CC(C)C)N(C(CC(C)C)CC(C)C)S(=O)O |
| InChI | InChI=1S/C18H39NO2S/c1-13(2)9-17(10-14(3)4)19(22(20)21)18(11-15(5)6)12-16(7)8/h13-18H,9-12H2,1-8H3,(H,20,21) |
| InChIKey | AXMXDPNODGSFIR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|