C20H30O2 — CID 91404243
(6S)-13-(furan-3-yl)-2,6,10-trimethyltrideca-2,7,9-trien-1-ol (PubChem CID 91404243) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (6S)-13-(furan-3-yl)-2,6,10-trimethyltrideca-2,7,9-trien-1-ol.
| Compound Name | (6S)-13-(furan-3-yl)-2,6,10-trimethyltrideca-2,7,9-trien-1-ol |
|---|---|
| PubChem CID | 91404243 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (6S)-13-(furan-3-yl)-2,6,10-trimethyltrideca-2,7,9-trien-1-ol |
| SMILES | CC(=CCC[C@H](C)C=CC=C(C)CCCc1ccoc1)CO |
| InChI | InChI=1S/C20H30O2/c1-17(9-5-11-19(3)15-21)7-4-8-18(2)10-6-12-20-13-14-22-16-20/h4,7-8,11,13-14,16-17,21H,5-6,9-10,12,15H2,1-3H3/t17-/m1/s1 |
| InChIKey | WXRUCWWVZFYDSA-QGZVFWFLSA-N |
| XLogP | 5.46 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|