C17H36N4O — CID 91406164
2-butan-2-yl-4,4-dimethyl-N-[3-[(N'-methylcarbamimidoyl)amino]propyl]hexanamide (PubChem CID 91406164) has the molecular formula C17H36N4O and a molecular weight of 312.50 g/mol. Its IUPAC name is 2-butan-2-yl-4,4-dimethyl-N-[3-[(N'-methylcarbamimidoyl)amino]propyl]hexanamide.
| Compound Name | 2-butan-2-yl-4,4-dimethyl-N-[3-[(N'-methylcarbamimidoyl)amino]propyl]hexanamide |
|---|---|
| PubChem CID | 91406164 |
| Molecular Formula | C17H36N4O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.29 |
| IUPAC Name | 2-butan-2-yl-4,4-dimethyl-N-[3-[(N'-methylcarbamimidoyl)amino]propyl]hexanamide |
| SMILES | CCC(C)C(CC(C)(C)CC)C(=O)NCCCN/C(N)=N/C |
| InChI | InChI=1S/C17H36N4O/c1-7-13(3)14(12-17(4,5)8-2)15(22)20-10-9-11-21-16(18)19-6/h13-14H,7-12H2,1-6H3,(H,20,22)(H3,18,19,21) |
| InChIKey | RSVJIVWNFWBWSK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|