C25H21F3N4O4 — CID 91410177
N-(cyanomethyl)-3,3-bis(4-hydroxyphenyl)-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]propanamide (PubChem CID 91410177) has the molecular formula C25H21F3N4O4 and a molecular weight of 498.46 g/mol. Its IUPAC name is N-(cyanomethyl)-3,3-bis(4-hydroxyphenyl)-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]propanamide.
| Compound Name | N-(cyanomethyl)-3,3-bis(4-hydroxyphenyl)-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]propanamide |
|---|---|
| PubChem CID | 91410177 |
| Molecular Formula | C25H21F3N4O4 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-(cyanomethyl)-3,3-bis(4-hydroxyphenyl)-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]propanamide |
| SMILES | N#CCNC(=O)C(NC(=O)Nc1ccc(C(F)(F)F)cc1)C(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C25H21F3N4O4/c26-25(27,28)17-5-7-18(8-6-17)31-24(36)32-22(23(35)30-14-13-29)21(15-1-9-19(33)10-2-15)16-3-11-20(34)12-4-16/h1-12,21-22,33-34H,14H2,(H,30,35)(H2,31,32,36) |
| InChIKey | FUZKPQUUZPBTLU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 134.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|