C7H5NO4 — CID 91411314
3-hydroxy-4H-furo[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 91411314) has the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. Its IUPAC name is 3-hydroxy-4H-furo[3,2-b]pyrrole-5-carboxylic acid.
| Compound Name | 3-hydroxy-4H-furo[3,2-b]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 91411314 |
| Molecular Formula | C7H5NO4 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 3-hydroxy-4H-furo[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | O=C(O)c1cc2occ(O)c2[nH]1 |
| InChI | InChI=1S/C7H5NO4/c9-4-2-12-5-1-3(7(10)11)8-6(4)5/h1-2,8-9H,(H,10,11) |
| InChIKey | HVFSNTWJSVUBRS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |