C19H11Cl2F7N6O — CID 91429973
2-chloro-N-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-6-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyldiazenyl]pyrimidin-4-amine (PubChem CID 91429973) has the molecular formula C19H11Cl2F7N6O and a molecular weight of 543.23 g/mol. Its IUPAC name is 2-chloro-N-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-6-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyldiazenyl]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-6-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyldiazenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91429973 |
| Molecular Formula | C19H11Cl2F7N6O |
| Molecular Weight | 543.23 g/mol |
| Exact Mass | 542.03 |
| IUPAC Name | 2-chloro-N-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-6-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyldiazenyl]pyrimidin-4-amine |
| SMILES | FC(F)C(F)(F)Oc1ccc(C/N=N/c2cc(Nc3cc(C(F)(F)F)cc(Cl)n3)nc(Cl)n2)cc1 |
| InChI | InChI=1S/C19H11Cl2F7N6O/c20-12-5-10(18(24,25)26)6-13(30-12)31-14-7-15(33-17(21)32-14)34-29-8-9-1-3-11(4-2-9)35-19(27,28)16(22)23/h1-7,16H,8H2,(H,30,31,32,33)/b34-29+ |
| InChIKey | IGBUWYJDFRJIGC-RIHQVDFKSA-N |
| XLogP | 7.46 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.23 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|