About acephenanthrylene
acephenanthrylene (PubChem CID 9143) has the molecular formula C16H10
and a molecular weight of 202.26 g/mol. Its IUPAC name is acephenanthrylene.
Molecular Properties
| Compound Name | acephenanthrylene |
| PubChem CID | 9143 |
| Molecular Formula | C16H10 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | acephenanthrylene |
| SMILES | C1=Cc2cc3ccccc3c3cccc1c23 |
| InChI | InChI=1S/C16H10/c1-2-6-14-12(4-1)10-13-9-8-11-5-3-7-15(14)16(11)13/h1-10H |
| InChIKey | SQFPKRNUGBRTAR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze acephenanthrylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acephenanthrylene?
The IUPAC name of acephenanthrylene (CID 9143) is acephenanthrylene.
What is the SMILES notation for acephenanthrylene?
The canonical SMILES for acephenanthrylene is C1=Cc2cc3ccccc3c3cccc1c23.
What is the InChIKey of acephenanthrylene?
The InChIKey is SQFPKRNUGBRTAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10/c1-2-6-14-12(4-1)10-13-9-8-11-5-3-7-15(14)16(11)13/h1-10H.
What are the key properties of acephenanthrylene?
acephenanthrylene has a molecular weight of 202.26 g/mol, XLogP of 4.48, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acephenanthrylene is sourced from PubChem (CID 9143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).